std::vector<DateTimeEventsManager::EventStartTimePair> DateTimeEventsManager::GetEventsNearestStartTime() const
{
	std::vector<EventStartTimePair> result;

	const std::vector<DateTimeEvent*> dateTimeEvents = GetDateTimeEvents();
	for (auto it = dateTimeEvents.begin(); it != dateTimeEvents.end(); ++it)
	{
		DateTimeEvent* event = *it;

		const boost::posix_time::ptime eventStartTime = GetEventStartTime(event);

		// Skip once events in the past.
		if (eventStartTime.is_not_a_date_time())
		{
			continue;
		}

		result.push_back(std::make_pair(event, eventStartTime));
	}

	std::sort(result.begin(), result.end(),
		boost::bind(&EventStartTimePair::second, _1) < boost::bind(&EventStartTimePair::second, _2));

	return result;
}

    inline boost::uint64_t hash_value(const boost::posix_time::ptime& value, boost::uint64_t seed)
    {
        seed = hash_value(value.date(), seed);
        seed = hash_value(value.time_of_day(), seed);

        return seed;
    }

int CH104_Transmit::AssembleSynTime(size_t bufIndex, unsigned char * buf, stSynTimePara para,boost::posix_time::ptime time)
{
	size_t count = bufIndex;

	buf[count++] = 0x68;
	count += ValToBuf(&buf[count],0,FrameLenLength_);
	count += ValToBuf(&buf[count],para.IFrameSendCounter_,2);
	count += ValToBuf(&buf[count],para.IFrameRecvCounter_,2);
	count += ValToBuf(&buf[count],M_CS_NA_1,FrameTypeLength_);
	count += ValToBuf(&buf[count],0x01,InfoNumLength_);
	count += ValToBuf(&buf[count],trans_act,TransReasonLength_);
	count += ValToBuf(&buf[count],para.addr_,AsduAddrLength_);
	count += ValToBuf(&buf[count],0,InfoAddrLength_);
	boost::posix_time::time_duration td = time.time_of_day();
	count += ValToBuf(&buf[count],td.total_milliseconds() % MinutesRemainderMillisecs,2);
	buf[count++] = td.minutes() & 0x3f;
	buf[count++] = td.hours() & 0x1f;
	boost::gregorian::date::ymd_type ymd = time.date().year_month_day();
	//buf[count++] = ymd.day & 0x1f;
	buf[count++] = ((time.date().day_of_week()<<5) & 0xe0) | (ymd.day & 0x1f);
	buf[count++] = ymd.month & 0x0f;
	buf[count++] = ymd.year % 100;

	int len = count - bufIndex - (FrameLenLength_ + SYN_HEAD_LENGTH);
	ValToBuf(&buf[FrameLenLocation_],len,FrameLenLength_);

	return count - bufIndex;
}

QDateTime pttoqt(const boost::posix_time::ptime &pt) {
	boost::gregorian::date gd = pt.date();
	boost::posix_time::time_duration gt = pt.time_of_day();
	QDate qdate(gd.year(), gd.month(), gd.day());
	QTime qtime(gt.hours(), gt.minutes(), gt.seconds());

	return QDateTime(qdate, qtime);
}

 //! Convert a time to a tm structure truncating any fractional seconds
 inline
 std::tm to_tm(const boost::posix_time::ptime& t) {
   std::tm timetm = boost::gregorian::to_tm(t.date());
   boost::posix_time::time_duration td = t.time_of_day();
   timetm.tm_hour = td.hours();
   timetm.tm_min = td.minutes();
   timetm.tm_sec = td.seconds();
   timetm.tm_isdst = -1; // -1 used when dst info is unknown
   return timetm;
 }

 //! Convert a time to a tm structure truncating any fractional seconds 
 inline
 tm to_tm(const boost::posix_time::ptime& t) {
   tm timetm = boost::gregorian::to_tm(t.date());
   boost::posix_time::time_duration td = t.time_of_day();
   timetm.tm_hour = td.hours(); 
   timetm.tm_min = td.minutes(); 
   timetm.tm_sec = td.seconds();
   timetm.tm_isdst = -1; //?
   return timetm;
 }

string AutoFlight::af_timestamp()
{
	const boost::posix_time::ptime time = boost::posix_time::second_clock::local_time();

	stringstream timestamp;
	timestamp << setw(4) << setfill('0') << time.date().year() << setw(2) << time.date().month().as_number() << setw(2) << time.date().day().as_number();
	timestamp << "T";
	timestamp << setw(2) << time.time_of_day().hours() << setw(2) << time.time_of_day().minutes() << setw(2) << time.time_of_day().seconds();

	return timestamp.str();
}

	static void FromBoostPtime(const boost::posix_time::ptime& pt, Time& t)
	{
		boost::gregorian::date d = pt.date();
		t.m_year = d.year();
		t.m_month = d.month();
		t.m_day = d.day();
		boost::posix_time::time_duration tod = pt.time_of_day();
		t.m_hour = tod.hours();
		t.m_minute = tod.minutes();
		t.m_second = tod.seconds();
		t.m_fraction_of_second = tod.fractional_seconds() / pow(10.0, tod.num_fractional_digits());
	}

    void BindArgDataHolder::ArgSetter::operator()( MYSQL_BIND &arg, const boost::posix_time::ptime &datetime )
    {
        MYSQL_TIME *ts = reinterpret_cast<MYSQL_TIME *>( arg.buffer );

        ts->year   = datetime.date().year();
        ts->month  = datetime.date().month();
        ts->day    = datetime.date().day();
        ts->hour   = datetime.time_of_day().hours();
        ts->minute = datetime.time_of_day().minutes();
        ts->second = datetime.time_of_day().seconds();

    }

std::string TimeConversion::toString(const boost::posix_time::ptime ts, const int secPrecision) const
{
	using namespace boost::posix_time;

	// determine the nanoseconds given in ts
	const int h = ts.time_of_day().hours();
	const int m = ts.time_of_day().minutes();
	const int s = ts.time_of_day().seconds();
	const time_duration r = time_duration(h, m, s);
	const time_duration rest = ts.time_of_day() - r;
	const int nanoseconds = int(rest.total_nanoseconds()); // not more than 1 bil nanoseconds here.

	return toString(to_tm(ts), nanoseconds, secPrecision);
}

void append_timestamp(Stream& stream, boost::posix_time::ptime timestamp)
{
    auto date         = timestamp.date();
    auto time         = timestamp.time_of_day();
    auto milliseconds = time.fractional_seconds() / 1000; // microseconds to milliseconds

    std::wstringstream buffer;

    buffer << std::setfill(L'0') << L"[" << std::setw(4) << date.year() << L"-" << std::setw(2)
           << date.month().as_number() << "-" << std::setw(2) << date.day().as_number() << L" " << std::setw(2)
           << time.hours() << L":" << std::setw(2) << time.minutes() << L":" << std::setw(2) << time.seconds() << L"."
           << std::setw(3) << milliseconds << L"] ";

    stream << buffer.str();
}

void readTag( const std::string& tag, Session& session, const boost::posix_time::ptime& snapshotTime ){
  IOVProxy proxy;
  if( snapshotTime.is_not_a_date_time() ) proxy = session.readIov( tag );
  else proxy = session.readIov( tag, snapshotTime );
  std::cout <<"> iov loaded size="<<proxy.loadedSize()<<std::endl;
  std::cout <<"> iov sequence size="<<proxy.sequenceSize()<<std::endl;
  IOVProxy::Iterator iovIt = proxy.find( 107 );
  if( iovIt == proxy.end() ){
    std::cout <<">[0] not found!"<<std::endl;
  } else {
    cond::Iov_t val = *iovIt;
    std::cout <<"#[0] iov since="<<val.since<<" till="<<val.till<<" pid="<<val.payloadId<<std::endl;
    boost::shared_ptr<std::string> pay0 = session.fetchPayload<std::string>( val.payloadId );
    std::cout <<"#[0] payload="<<*pay0<<std::endl;
  }
  iovIt = proxy.find( 235 );
  if( iovIt == proxy.end() ){
    std::cout <<">[1] not found!"<<std::endl;
  } else {
    cond::Iov_t val = *iovIt;
    std::cout <<"#[1] iov since="<<val.since<<" till="<<val.till<<" pid="<<val.payloadId<<std::endl;
    boost::shared_ptr<std::string> pay0 = session.fetchPayload<std::string>( val.payloadId );
    std::cout <<"#[1] payload="<<*pay0<<std::endl;
  }
}

boost::posix_time::ptime
MetaModelConf::
findNextrun(const boost::posix_time::ptime &refTime)const
{
	ptime now( (nowTime__.is_special()?second_clock::universal_time():nowTime__) );
	ptime midnight( now.date(), time_duration(0, 0, 0, 0) );
	time_duration tdNow( now.time_of_day() );
	

	if( nextrun_.empty() )
		return ptime(); //Udefined.
	
	if( specType==Absolute) {
		TimeDurationList::const_iterator it=nextrun_.begin();
		for( ; it != nextrun_.end() && *it < tdNow ; ++it );

		if( it == nextrun_.end() ) {
			midnight += hours( 24 ); //next day
			it = nextrun_.begin();
		}

		return midnight + *it;
	} else if( specType == RelativeToLoadTime ){
		if( refTime.is_special() || nextrun_.empty())
			return ptime();  // undefined

		return refTime + (*nextrun_.begin());
	} else {
		return ptime();  // Undefined
	}
}

void
cluster_helper_c::create_tags_for_track_statistics(KaxTags &tags,
                                                   std::string const &writing_app,
                                                   boost::posix_time::ptime const &writing_date) {
  auto writing_date_str = !writing_date.is_not_a_date_time() ? mtx::date_time::to_string(writing_date, "%Y-%m-%d %H:%M:%S") : "1970-01-01 00:00:00";

  for (auto const &ptzr : g_packetizers) {
    auto track_uid    = ptzr.packetizer->get_uid();
    auto const &stats = m->track_statistics[track_uid];
    auto bps          = stats.get_bits_per_second();
    auto duration     = stats.get_duration();

    mtx::tags::remove_simple_tags_for<KaxTagTrackUID>(tags, track_uid, "BPS");
    mtx::tags::remove_simple_tags_for<KaxTagTrackUID>(tags, track_uid, "DURATION");
    mtx::tags::remove_simple_tags_for<KaxTagTrackUID>(tags, track_uid, "NUMBER_OF_FRAMES");
    mtx::tags::remove_simple_tags_for<KaxTagTrackUID>(tags, track_uid, "NUMBER_OF_BYTES");

    auto tag = mtx::tags::find_tag_for<KaxTagTrackUID>(tags, track_uid, mtx::tags::Movie, true);

    mtx::tags::set_target_type(*tag, mtx::tags::Movie, "MOVIE");

    mtx::tags::set_simple(*tag, "BPS",              to_string(bps ? *bps : 0));
    mtx::tags::set_simple(*tag, "DURATION",         format_timecode(duration ? *duration : 0));
    mtx::tags::set_simple(*tag, "NUMBER_OF_FRAMES", to_string(stats.get_num_frames()));
    mtx::tags::set_simple(*tag, "NUMBER_OF_BYTES",  to_string(stats.get_num_bytes()));

    mtx::tags::set_simple(*tag, "_STATISTICS_WRITING_APP",      writing_app);
    mtx::tags::set_simple(*tag, "_STATISTICS_WRITING_DATE_UTC", writing_date_str);
    mtx::tags::set_simple(*tag, "_STATISTICS_TAGS",             "BPS DURATION NUMBER_OF_FRAMES NUMBER_OF_BYTES");
  }

  m->track_statistics.clear();
}

/** Sets the date and time using a boost::posix_time::ptime
 *
 * @param _ptime :: boost::posix_time::ptime date and time.
 */
void DateAndTime::set_from_ptime(boost::posix_time::ptime _ptime) {
  if (_ptime.is_special()) {
    // --- SPECIAL VALUES! ----
    if (_ptime.is_infinity() || _ptime.is_pos_infinity())
      _nanoseconds = MAX_NANOSECONDS;
    if (_ptime.is_neg_infinity())
      _nanoseconds = MIN_NANOSECONDS;
    if (_ptime.is_not_a_date_time())
      _nanoseconds = MIN_NANOSECONDS;
  } else {
    _nanoseconds =
        nanosecondsFromDuration(_ptime - DateAndTimeHelpers::GPS_EPOCH);

    // Check for overflow
    if (_nanoseconds < 0) {
      if (_ptime.date().year() >= 1990) {
        // nanoseconds is negative despite the year being higher than 1990
        // ... means overflow occured
        this->setToMaximum();
      }
    } else if (_nanoseconds > 0) {
      if (_ptime.date().year() < 1990) {
        // Nanoseconds is positive but the year is below 1990 = it should be
        // negative!
        this->setToMinimum();
      }
    }
  }
}

std::pair< comma::uint32, comma::uint32 > to_ntp_time( boost::posix_time::ptime t )
{
    if( t < ntp_base ) { COMMA_THROW_STREAM( comma::exception, "cannot convert to ntp time: " << t << ", which is less than NTP time base " << ntp_base ); }
    comma::int32 s = ( t - epoch_time ).total_seconds(); // 32 bit signed int in boost and posix
    comma::int32 m = t.time_of_day().total_microseconds() % 1000000;
    if( t >= epoch_time || m == 0 )
    {
        return std::pair< comma::uint32, comma::uint32 >( static_cast< comma::uint32 >( ntp_diff + s ), static_cast< comma::uint32 >( m / ntp_microsec_coeff ) );
    }
    else
    {
        return std::pair< comma::uint32, comma::uint32 >( static_cast< comma::uint32 >( ntp_diff + s - 1 ), static_cast< comma::uint32 >( m / ntp_microsec_coeff ) );
    }
}

void 
webfw::
DefaultResponse::
expire( const boost::posix_time::ptime &exp )
{
   Response::expire( exp );
   
   if( ! exp.is_special() ) {                                 
      std::string rfc1123;                                       
      rfc1123 = miutil::rfc1123date( exp );                   
                                                                     
      if( ! rfc1123.empty() )
         out_ << "Expire: " << rfc1123 << std::endl;     
   }
}

void
PreparedStatement::bind(size_t param, const boost::posix_time::ptime &value)
{
    if (value.is_not_a_date_time()) {
        bind(param, Null());
        return;
    }
    ensure(param);
    m_paramValues[param - 1].resize(8);
    long long ticks = (value - postgres_epoch).total_microseconds();
    *(long long *)&m_paramValues[param - 1][0] = byteswapOnLittleEndian(*(long long *)&ticks);
    m_params[param - 1] = m_paramValues[param - 1].c_str();
    m_paramLengths[param - 1] = m_paramValues[param - 1].size();
    m_paramFormats[param - 1] = 1;
    setType(param, TIMESTAMPOID);
}

double getAlpha(
    boost::posix_time::ptime& tstamp_prev,
    double max_life)
{
    auto now = boost::posix_time::microsec_clock::universal_time();
    double alpha = 1.0;  // Default is 100% opacity.
    if (!tstamp_prev.is_not_a_date_time()) 
    {
        // alpha = min {delta_t, max_life} / max_life
        auto tdelta = now - tstamp_prev;
        alpha = tdelta.total_nanoseconds()/1000000000.;
        alpha = std::min(alpha, max_life);
        alpha /= max_life;
    }
    tstamp_prev = now;
    return alpha;
}

void HistoryManager::appendEntryToFile(std::ofstream &os, bool isSent, const boost::posix_time::ptime &saveTime, const std::string &content)
{
    if(saveTime.is_not_a_date_time())
        return;
    if(os.tellp() != 0)
        os << std::endl;
    os << "[" << FormattingUtils::dateToStr(saveTime) << "]";
    if(isSent)
    {
        os << "-S-";
    }
    else
    {
        os << "-R-";
    }
    os << content;
}